C20H21NO3S — CID 158569151
N-(2-acetyl-5-phenylphenyl)cyclohexene-1-sulfonamide (PubChem CID 158569151) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-(2-acetyl-5-phenylphenyl)cyclohexene-1-sulfonamide.
| Compound Name | N-(2-acetyl-5-phenylphenyl)cyclohexene-1-sulfonamide |
|---|---|
| PubChem CID | 158569151 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-(2-acetyl-5-phenylphenyl)cyclohexene-1-sulfonamide |
| SMILES | CC(=O)c1ccc(-c2ccccc2)cc1NS(=O)(=O)C1=CCCCC1 |
| InChI | InChI=1S/C20H21NO3S/c1-15(22)19-13-12-17(16-8-4-2-5-9-16)14-20(19)21-25(23,24)18-10-6-3-7-11-18/h2,4-5,8-10,12-14,21H,3,6-7,11H2,1H3 |
| InChIKey | HRWDEMLXBHYNNB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |