C20H16FNO4S — CID 171346728
5-fluoro-2-[[4-(3-methylphenyl)phenyl]sulfonylamino]benzoic acid (PubChem CID 171346728) has the molecular formula C20H16FNO4S and a molecular weight of 385.42 g/mol. Its IUPAC name is 5-fluoro-2-[[4-(3-methylphenyl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 5-fluoro-2-[[4-(3-methylphenyl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 171346728 |
| Molecular Formula | C20H16FNO4S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 5-fluoro-2-[[4-(3-methylphenyl)phenyl]sulfonylamino]benzoic acid |
| SMILES | Cc1cccc(-c2ccc(S(=O)(=O)Nc3ccc(F)cc3C(=O)O)cc2)c1 |
| InChI | InChI=1S/C20H16FNO4S/c1-13-3-2-4-15(11-13)14-5-8-17(9-6-14)27(25,26)22-19-10-7-16(21)12-18(19)20(23)24/h2-12,22H,1H3,(H,23,24) |
| InChIKey | SJDRDKLPZUGCGC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |