C20H15FN2O5S — CID 12017257
4-[[2-(benzenesulfonamido)-5-fluorobenzoyl]amino]benzoic acid (PubChem CID 12017257) has the molecular formula C20H15FN2O5S and a molecular weight of 414.41 g/mol. Its IUPAC name is 4-[[2-(benzenesulfonamido)-5-fluorobenzoyl]amino]benzoic acid.
| Compound Name | 4-[[2-(benzenesulfonamido)-5-fluorobenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 12017257 |
| Molecular Formula | C20H15FN2O5S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 4-[[2-(benzenesulfonamido)-5-fluorobenzoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cc(F)ccc2NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15FN2O5S/c21-14-8-11-18(23-29(27,28)16-4-2-1-3-5-16)17(12-14)19(24)22-15-9-6-13(7-10-15)20(25)26/h1-12,23H,(H,22,24)(H,25,26) |
| InChIKey | ZACAZWMICZRXQH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |