C23H22F2N2O3S — CID 2730339
4-tert-butyl-N-[4-[(2,4-difluorophenyl)sulfamoyl]phenyl]benzamide (PubChem CID 2730339) has the molecular formula C23H22F2N2O3S and a molecular weight of 444.50 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[(2,4-difluorophenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[(2,4-difluorophenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 2730339 |
| Molecular Formula | C23H22F2N2O3S |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-tert-butyl-N-[4-[(2,4-difluorophenyl)sulfamoyl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3ccc(F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C23H22F2N2O3S/c1-23(2,3)16-6-4-15(5-7-16)22(28)26-18-9-11-19(12-10-18)31(29,30)27-21-13-8-17(24)14-20(21)25/h4-14,27H,1-3H3,(H,26,28) |
| InChIKey | GGMLKQMHAFAJGI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |