C28H26FN3O3S — CID 58639464
N-(4-tert-butylphenyl)-4-[3-[(4-fluorophenyl)sulfonylamino]-2-pyridinyl]benzamide (PubChem CID 58639464) has the molecular formula C28H26FN3O3S and a molecular weight of 503.60 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-[3-[(4-fluorophenyl)sulfonylamino]-2-pyridinyl]benzamide.
| Compound Name | N-(4-tert-butylphenyl)-4-[3-[(4-fluorophenyl)sulfonylamino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 58639464 |
| Molecular Formula | C28H26FN3O3S |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-[3-[(4-fluorophenyl)sulfonylamino]-2-pyridinyl]benzamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2ccc(-c3ncccc3NS(=O)(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H26FN3O3S/c1-28(2,3)21-10-14-23(15-11-21)31-27(33)20-8-6-19(7-9-20)26-25(5-4-18-30-26)32-36(34,35)24-16-12-22(29)13-17-24/h4-18,32H,1-3H3,(H,31,33) |
| InChIKey | YICAEOFWEXUXKW-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |