C19H17N3O5S2 — CID 59672870
4-(3-methylsulfonyl-2-pyridinyl)-N-(4-sulfamoylphenyl)benzamide (PubChem CID 59672870) has the molecular formula C19H17N3O5S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 4-(3-methylsulfonyl-2-pyridinyl)-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 4-(3-methylsulfonyl-2-pyridinyl)-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 59672870 |
| Molecular Formula | C19H17N3O5S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 4-(3-methylsulfonyl-2-pyridinyl)-N-(4-sulfamoylphenyl)benzamide |
| SMILES | CS(=O)(=O)c1cccnc1-c1ccc(C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H17N3O5S2/c1-28(24,25)17-3-2-12-21-18(17)13-4-6-14(7-5-13)19(23)22-15-8-10-16(11-9-15)29(20,26)27/h2-12H,1H3,(H,22,23)(H2,20,26,27) |
| InChIKey | WJFNQEXJOLNCHG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |