C21H18F3N3O5S2 — CID 58639617
4-[3-[bis(methylsulfonyl)amino]-2-pyridinyl]-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 58639617) has the molecular formula C21H18F3N3O5S2 and a molecular weight of 513.52 g/mol. Its IUPAC name is 4-[3-[bis(methylsulfonyl)amino]-2-pyridinyl]-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[3-[bis(methylsulfonyl)amino]-2-pyridinyl]-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58639617 |
| Molecular Formula | C21H18F3N3O5S2 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | 4-[3-[bis(methylsulfonyl)amino]-2-pyridinyl]-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CS(=O)(=O)N(c1cccnc1-c1ccc(C(=O)Nc2ccc(C(F)(F)F)cc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C21H18F3N3O5S2/c1-33(29,30)27(34(2,31)32)18-4-3-13-25-19(18)14-5-7-15(8-6-14)20(28)26-17-11-9-16(10-12-17)21(22,23)24/h3-13H,1-2H3,(H,26,28) |
| InChIKey | FTONDTDNKGDASK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |