C17H19F2NO2S — CID 3314659
N-(2,4-difluorophenyl)-4-(2-methylbutan-2-yl)benzenesulfonamide (PubChem CID 3314659) has the molecular formula C17H19F2NO2S and a molecular weight of 339.41 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(2-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(2-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3314659 |
| Molecular Formula | C17H19F2NO2S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(2-methylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H19F2NO2S/c1-4-17(2,3)12-5-8-14(9-6-12)23(21,22)20-16-10-7-13(18)11-15(16)19/h5-11,20H,4H2,1-3H3 |
| InChIKey | WBGWJCPPWRZMTO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |