C16H13F2N3O4S — CID 3328350
N-(2,4-difluorophenyl)-1,3-dimethyl-2,4-dioxoquinazoline-6-sulfonamide (PubChem CID 3328350) has the molecular formula C16H13F2N3O4S and a molecular weight of 381.36 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1,3-dimethyl-2,4-dioxoquinazoline-6-sulfonamide.
| Compound Name | N-(2,4-difluorophenyl)-1,3-dimethyl-2,4-dioxoquinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 3328350 |
| Molecular Formula | C16H13F2N3O4S |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-1,3-dimethyl-2,4-dioxoquinazoline-6-sulfonamide |
| SMILES | Cn1c(=O)c2cc(S(=O)(=O)Nc3ccc(F)cc3F)ccc2n(C)c1=O |
| InChI | InChI=1S/C16H13F2N3O4S/c1-20-14-6-4-10(8-11(14)15(22)21(2)16(20)23)26(24,25)19-13-5-3-9(17)7-12(13)18/h3-8,19H,1-2H3 |
| InChIKey | GBZCHBRRUWURKJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |