C12H13N3O6S — CID 46786417
2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]acetic acid (PubChem CID 46786417) has the molecular formula C12H13N3O6S and a molecular weight of 327.32 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]acetic acid.
| Compound Name | 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 46786417 |
| Molecular Formula | C12H13N3O6S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]acetic acid |
| SMILES | Cn1c(=O)c2cc(S(=O)(=O)NCC(=O)O)ccc2n(C)c1=O |
| InChI | InChI=1S/C12H13N3O6S/c1-14-9-4-3-7(22(20,21)13-6-10(16)17)5-8(9)11(18)15(2)12(14)19/h3-5,13H,6H2,1-2H3,(H,16,17) |
| InChIKey | XGHMMYTYCYEDEM-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |