C16H16N6O7S2 — CID 46257550
3-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]-N-(5-nitro-1,3-thiazol-2-yl)propanamide (PubChem CID 46257550) has the molecular formula C16H16N6O7S2 and a molecular weight of 468.47 g/mol. Its IUPAC name is 3-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]-N-(5-nitro-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]-N-(5-nitro-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 46257550 |
| Molecular Formula | C16H16N6O7S2 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 3-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]-N-(5-nitro-1,3-thiazol-2-yl)propanamide |
| SMILES | Cn1c(=O)c2cc(S(=O)(=O)NCCC(=O)Nc3ncc([N+](=O)[O-])s3)ccc2n(C)c1=O |
| InChI | InChI=1S/C16H16N6O7S2/c1-20-11-4-3-9(7-10(11)14(24)21(2)16(20)25)31(28,29)18-6-5-12(23)19-15-17-8-13(30-15)22(26)27/h3-4,7-8,18H,5-6H2,1-2H3,(H,17,19,23) |
| InChIKey | MSIQWLLUBRAZFF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|