C16H16N6O7S2 — CID 20865946
2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(5-nitro-1,3-thiazol-2-yl)acetamide (PubChem CID 20865946) has the molecular formula C16H16N6O7S2 and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(5-nitro-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 20865946 |
| Molecular Formula | C16H16N6O7S2 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
| SMILES | CN(CC(=O)Nc1ncc([N+](=O)[O-])s1)S(=O)(=O)c1ccc2c(c1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H16N6O7S2/c1-19(8-12(23)18-15-17-7-13(30-15)22(26)27)31(28,29)9-4-5-11-10(6-9)14(24)21(3)16(25)20(11)2/h4-7H,8H2,1-3H3,(H,17,18,23) |
| InChIKey | FPSURDOYLLPFQY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 166.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|