C17H21ClN4O7S2 — CID 53298120
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]acetamide (PubChem CID 53298120) has the molecular formula C17H21ClN4O7S2 and a molecular weight of 492.96 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]acetamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 53298120 |
| Molecular Formula | C17H21ClN4O7S2 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]acetamide |
| SMILES | CN(CC(=O)NC1CS(=O)(=O)CC1Cl)S(=O)(=O)c1ccc2c(c1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H21ClN4O7S2/c1-20(7-15(23)19-13-9-30(26,27)8-12(13)18)31(28,29)10-4-5-14-11(6-10)16(24)22(3)17(25)21(14)2/h4-6,12-13H,7-9H2,1-3H3,(H,19,23) |
| InChIKey | YHOROZLWQIRHME-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 144.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|