C17H20N6O5S3 — CID 20865974
2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 20865974) has the molecular formula C17H20N6O5S3 and a molecular weight of 484.59 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 20865974 |
| Molecular Formula | C17H20N6O5S3 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CN(C)S(=O)(=O)c2ccc3c(c2)c(=O)n(C)c(=O)n3C)s1 |
| InChI | InChI=1S/C17H20N6O5S3/c1-5-29-16-20-19-15(30-16)18-13(24)9-21(2)31(27,28)10-6-7-12-11(8-10)14(25)23(4)17(26)22(12)3/h6-8H,5,9H2,1-4H3,(H,18,19,24) |
| InChIKey | GTBFPYITFGLEQP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|