C18H19N5O4S4 — CID 55382535
2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 55382535) has the molecular formula C18H19N5O4S4 and a molecular weight of 497.65 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 55382535 |
| Molecular Formula | C18H19N5O4S4 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)Nc2nnc(SCc3cccs3)s2)cc1 |
| InChI | InChI=1S/C18H19N5O4S4/c1-12(24)19-13-5-7-15(8-6-13)31(26,27)23(2)10-16(25)20-17-21-22-18(30-17)29-11-14-4-3-9-28-14/h3-9H,10-11H2,1-2H3,(H,19,24)(H,20,21,25) |
| InChIKey | ZJGOVMJBPUEUGZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|