C11H13N3O3S4 — CID 52511700
(2S)-2-methylsulfonyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 52511700) has the molecular formula C11H13N3O3S4 and a molecular weight of 363.51 g/mol. Its IUPAC name is (2S)-2-methylsulfonyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | (2S)-2-methylsulfonyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 52511700 |
| Molecular Formula | C11H13N3O3S4 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | (2S)-2-methylsulfonyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1nnc(SCc2cccs2)s1)S(C)(=O)=O |
| InChI | InChI=1S/C11H13N3O3S4/c1-7(21(2,16)17)9(15)12-10-13-14-11(20-10)19-6-8-4-3-5-18-8/h3-5,7H,6H2,1-2H3,(H,12,13,15)/t7-/m0/s1 |
| InChIKey | CKPTWSNKEZSBHI-ZETCQYMHSA-N |
| XLogP | 2.26 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|