C16H15N3OS4 — CID 75855263
2-phenylsulfanyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 75855263) has the molecular formula C16H15N3OS4 and a molecular weight of 393.58 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2-phenylsulfanyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 75855263 |
| Molecular Formula | C16H15N3OS4 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 2-phenylsulfanyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CC(Sc1ccccc1)C(=O)Nc1nnc(SCc2cccs2)s1 |
| InChI | InChI=1S/C16H15N3OS4/c1-11(23-12-6-3-2-4-7-12)14(20)17-15-18-19-16(24-15)22-10-13-8-5-9-21-13/h2-9,11H,10H2,1H3,(H,17,18,20) |
| InChIKey | PHXPYFGEKFAIII-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|