C17H17N3OS4 — CID 112773123
2-propan-2-ylsulfanyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 112773123) has the molecular formula C17H17N3OS4 and a molecular weight of 407.61 g/mol. Its IUPAC name is 2-propan-2-ylsulfanyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-propan-2-ylsulfanyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 112773123 |
| Molecular Formula | C17H17N3OS4 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-propan-2-ylsulfanyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CC(C)Sc1ccccc1C(=O)Nc1nnc(SCc2cccs2)s1 |
| InChI | InChI=1S/C17H17N3OS4/c1-11(2)24-14-8-4-3-7-13(14)15(21)18-16-19-20-17(25-16)23-10-12-6-5-9-22-12/h3-9,11H,10H2,1-2H3,(H,18,19,21) |
| InChIKey | UCRJDZASZTWXCK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|