C22H18N4O2S3 — CID 55429615
3-(cyclopropanecarbonylamino)-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide (PubChem CID 55429615) has the molecular formula C22H18N4O2S3 and a molecular weight of 466.61 g/mol. Its IUPAC name is 3-(cyclopropanecarbonylamino)-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide.
| Compound Name | 3-(cyclopropanecarbonylamino)-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 55429615 |
| Molecular Formula | C22H18N4O2S3 |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 3-(cyclopropanecarbonylamino)-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]naphthalene-2-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2cccs2)s1)c1cc2ccccc2cc1NC(=O)C1CC1 |
| InChI | InChI=1S/C22H18N4O2S3/c27-19(13-7-8-13)23-18-11-15-5-2-1-4-14(15)10-17(18)20(28)24-21-25-26-22(31-21)30-12-16-6-3-9-29-16/h1-6,9-11,13H,7-8,12H2,(H,23,27)(H,24,25,28) |
| InChIKey | LTJUDOPPSMEPAC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|