C19H16N4O2S4 — CID 55434316
2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 55434316) has the molecular formula C19H16N4O2S4 and a molecular weight of 460.63 g/mol. Its IUPAC name is 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 55434316 |
| Molecular Formula | C19H16N4O2S4 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1cc(CSc2ccccc2C(=O)Nc2nnc(SCc3cccs3)s2)on1 |
| InChI | InChI=1S/C19H16N4O2S4/c1-12-9-13(25-23-12)10-27-16-7-3-2-6-15(16)17(24)20-18-21-22-19(29-18)28-11-14-5-4-8-26-14/h2-9H,10-11H2,1H3,(H,20,21,24) |
| InChIKey | LKVAHDQNXHJUEJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|