C18H15Cl2N3O2S — CID 55522562
N-(4-amino-3,5-dichlorophenyl)-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide (PubChem CID 55522562) has the molecular formula C18H15Cl2N3O2S and a molecular weight of 408.31 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 55522562 |
| Molecular Formula | C18H15Cl2N3O2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide |
| SMILES | Cc1cc(CSc2ccccc2C(=O)Nc2cc(Cl)c(N)c(Cl)c2)on1 |
| InChI | InChI=1S/C18H15Cl2N3O2S/c1-10-6-12(25-23-10)9-26-16-5-3-2-4-13(16)18(24)22-11-7-14(19)17(21)15(20)8-11/h2-8H,9,21H2,1H3,(H,22,24) |
| InChIKey | AECBTHREOOMMLV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|