C20H19F2N3O2S — CID 55908201
N-[4-(dimethylamino)-3,5-difluorophenyl]-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide (PubChem CID 55908201) has the molecular formula C20H19F2N3O2S and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3,5-difluorophenyl]-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide.
| Compound Name | N-[4-(dimethylamino)-3,5-difluorophenyl]-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 55908201 |
| Molecular Formula | C20H19F2N3O2S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[4-(dimethylamino)-3,5-difluorophenyl]-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzamide |
| SMILES | Cc1cc(CSc2ccccc2C(=O)Nc2cc(F)c(N(C)C)c(F)c2)on1 |
| InChI | InChI=1S/C20H19F2N3O2S/c1-12-8-14(27-24-12)11-28-18-7-5-4-6-15(18)20(26)23-13-9-16(21)19(25(2)3)17(22)10-13/h4-10H,11H2,1-3H3,(H,23,26) |
| InChIKey | IDANYWYRKAURFF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|