C22H22ClN3O4S — CID 55878277
2-chloro-N-(2-methoxyethyl)-4-[[2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzoyl]amino]benzamide (PubChem CID 55878277) has the molecular formula C22H22ClN3O4S and a molecular weight of 459.96 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxyethyl)-4-[[2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzoyl]amino]benzamide.
| Compound Name | 2-chloro-N-(2-methoxyethyl)-4-[[2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 55878277 |
| Molecular Formula | C22H22ClN3O4S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 2-chloro-N-(2-methoxyethyl)-4-[[2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzoyl]amino]benzamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)c2ccccc2SCc2cc(C)no2)cc1Cl |
| InChI | InChI=1S/C22H22ClN3O4S/c1-14-11-16(30-26-14)13-31-20-6-4-3-5-18(20)22(28)25-15-7-8-17(19(23)12-15)21(27)24-9-10-29-2/h3-8,11-12H,9-10,13H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | ROUVACKTSOLEHC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|