C21H22N2O2S2 — CID 51246358
2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide (PubChem CID 51246358) has the molecular formula C21H22N2O2S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide.
| Compound Name | 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide |
|---|---|
| PubChem CID | 51246358 |
| Molecular Formula | C21H22N2O2S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide |
| SMILES | Cc1ccc(SCCNC(=O)c2ccccc2SCc2cc(C)no2)cc1 |
| InChI | InChI=1S/C21H22N2O2S2/c1-15-7-9-18(10-8-15)26-12-11-22-21(24)19-5-3-4-6-20(19)27-14-17-13-16(2)23-25-17/h3-10,13H,11-12,14H2,1-2H3,(H,22,24) |
| InChIKey | UZRKTUDFCRJPJV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|