C18H13ClN4O2S3 — CID 112773119
3-(2-chlorophenyl)-5-methyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1,2-oxazole-4-carboxamide (PubChem CID 112773119) has the molecular formula C18H13ClN4O2S3 and a molecular weight of 448.98 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-methyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-5-methyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 112773119 |
| Molecular Formula | C18H13ClN4O2S3 |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | 3-(2-chlorophenyl)-5-methyl-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)Nc1nnc(SCc2cccs2)s1 |
| InChI | InChI=1S/C18H13ClN4O2S3/c1-10-14(15(23-25-10)12-6-2-3-7-13(12)19)16(24)20-17-21-22-18(28-17)27-9-11-5-4-8-26-11/h2-8H,9H2,1H3,(H,20,21,24) |
| InChIKey | DITMOYCLIHYILX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|