C17H17ClN4O2S2 — CID 3274120
N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 3274120) has the molecular formula C17H17ClN4O2S2 and a molecular weight of 408.94 g/mol. Its IUPAC name is N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3274120 |
| Molecular Formula | C17H17ClN4O2S2 |
| Molecular Weight | 408.94 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCC(C)Sc1nnc(NC(=O)c2c(-c3ccccc3Cl)noc2C)s1 |
| InChI | InChI=1S/C17H17ClN4O2S2/c1-4-9(2)25-17-21-20-16(26-17)19-15(23)13-10(3)24-22-14(13)11-7-5-6-8-12(11)18/h5-9H,4H2,1-3H3,(H,19,20,23) |
| InChIKey | GLGJRXYOTJXJCV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.94 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|