C21H15ClFN5O3S2 — CID 40833189
3-(2-chlorophenyl)-N-[5-[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 40833189) has the molecular formula C21H15ClFN5O3S2 and a molecular weight of 503.97 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[5-[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-[5-[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 40833189 |
| Molecular Formula | C21H15ClFN5O3S2 |
| Molecular Weight | 503.97 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[5-[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)Nc1nnc(SCC(=O)Nc2cccc(F)c2)s1 |
| InChI | InChI=1S/C21H15ClFN5O3S2/c1-11-17(18(28-31-11)14-7-2-3-8-15(14)22)19(30)25-20-26-27-21(33-20)32-10-16(29)24-13-6-4-5-12(23)9-13/h2-9H,10H2,1H3,(H,24,29)(H,25,26,30) |
| InChIKey | YUECYOOEEAFNCA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.97 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|