C23H25FN4O5S2 — CID 16825490
3,4,5-triethoxy-N-[5-[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 16825490) has the molecular formula C23H25FN4O5S2 and a molecular weight of 520.61 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[5-[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[5-[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 16825490 |
| Molecular Formula | C23H25FN4O5S2 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 3,4,5-triethoxy-N-[5-[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2nnc(SCC(=O)Nc3cccc(F)c3)s2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H25FN4O5S2/c1-4-31-17-10-14(11-18(32-5-2)20(17)33-6-3)21(30)26-22-27-28-23(35-22)34-13-19(29)25-16-9-7-8-15(24)12-16/h7-12H,4-6,13H2,1-3H3,(H,25,29)(H,26,27,30) |
| InChIKey | ABDOADVCWFCEFU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|