C24H28N4O5S2 — CID 40833002
N-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4,5-triethoxybenzamide (PubChem CID 40833002) has the molecular formula C24H28N4O5S2 and a molecular weight of 516.65 g/mol. Its IUPAC name is N-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 40833002 |
| Molecular Formula | C24H28N4O5S2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | N-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2nnc(SCC(=O)NCc3ccccc3)s2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H28N4O5S2/c1-4-31-18-12-17(13-19(32-5-2)21(18)33-6-3)22(30)26-23-27-28-24(35-23)34-15-20(29)25-14-16-10-8-7-9-11-16/h7-13H,4-6,14-15H2,1-3H3,(H,25,29)(H,26,27,30) |
| InChIKey | RLOSMQOAJUMMBY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|