C22H24N4O5S2 — CID 40832715
3,4,5-trimethoxy-N-[5-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 40832715) has the molecular formula C22H24N4O5S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 40832715 |
| Molecular Formula | C22H24N4O5S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-[2-oxo-2-(2-phenylethylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2nnc(SCC(=O)NCCc3ccccc3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C22H24N4O5S2/c1-29-16-11-15(12-17(30-2)19(16)31-3)20(28)24-21-25-26-22(33-21)32-13-18(27)23-10-9-14-7-5-4-6-8-14/h4-8,11-12H,9-10,13H2,1-3H3,(H,23,27)(H,24,25,28) |
| InChIKey | PHOVFYOKYQPROA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|