C21H13N3O2S3 — CID 55505406
9-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]fluorene-2-carboxamide (PubChem CID 55505406) has the molecular formula C21H13N3O2S3 and a molecular weight of 435.56 g/mol. Its IUPAC name is 9-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]fluorene-2-carboxamide.
| Compound Name | 9-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]fluorene-2-carboxamide |
|---|---|
| PubChem CID | 55505406 |
| Molecular Formula | C21H13N3O2S3 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 9-oxo-N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]fluorene-2-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2cccs2)s1)c1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H13N3O2S3/c25-18-16-6-2-1-5-14(16)15-8-7-12(10-17(15)18)19(26)22-20-23-24-21(29-20)28-11-13-4-3-9-27-13/h1-10H,11H2,(H,22,23,26) |
| InChIKey | BTRVAHPOLNEEMW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|