C23H14FN3O4S3 — CID 16550785
N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 16550785) has the molecular formula C23H14FN3O4S3 and a molecular weight of 511.58 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 16550785 |
| Molecular Formula | C23H14FN3O4S3 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2F)s1)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H14FN3O4S3/c24-17-7-3-1-5-14(17)12-32-23-27-26-22(33-23)25-21(29)13-9-10-16-19(11-13)34(30,31)18-8-4-2-6-15(18)20(16)28/h1-11H,12H2,(H,25,26,29) |
| InChIKey | HGDVKWYRMYGKLF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|