C17H13F2N3OS2 — CID 42805533
N-[5-[(2,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide (PubChem CID 42805533) has the molecular formula C17H13F2N3OS2 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[5-[(2,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide.
| Compound Name | N-[5-[(2,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 42805533 |
| Molecular Formula | C17H13F2N3OS2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-[5-[(2,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(SCc3ccc(F)cc3F)s2)cc1 |
| InChI | InChI=1S/C17H13F2N3OS2/c1-10-2-4-11(5-3-10)15(23)20-16-21-22-17(25-16)24-9-12-6-7-13(18)8-14(12)19/h2-8H,9H2,1H3,(H,20,21,23) |
| InChIKey | TVBGCOAYGNCCSC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|