C13H9F2N5OS3 — CID 121029235
N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylthiadiazole-5-carboxamide (PubChem CID 121029235) has the molecular formula C13H9F2N5OS3 and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 121029235 |
| Molecular Formula | C13H9F2N5OS3 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)Nc1nnc(SCc2cc(F)ccc2F)s1 |
| InChI | InChI=1S/C13H9F2N5OS3/c1-6-10(24-20-17-6)11(21)16-12-18-19-13(23-12)22-5-7-4-8(14)2-3-9(7)15/h2-4H,5H2,1H3,(H,16,18,21) |
| InChIKey | HBGLFYMZHJEZCC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|