C15H11F2N3OS3 — CID 121029575
N-[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylthiophene-2-carboxamide (PubChem CID 121029575) has the molecular formula C15H11F2N3OS3 and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylthiophene-2-carboxamide.
| Compound Name | N-[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 121029575 |
| Molecular Formula | C15H11F2N3OS3 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | N-[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2nnc(SCc3ccc(F)c(F)c3)s2)c1 |
| InChI | InChI=1S/C15H11F2N3OS3/c1-8-4-12(22-6-8)13(21)18-14-19-20-15(24-14)23-7-9-2-3-10(16)11(17)5-9/h2-6H,7H2,1H3,(H,18,19,21) |
| InChIKey | HDTWCXRJEGPZIN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|