C9H9N3OS3 — CID 121029454
4-methyl-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide (PubChem CID 121029454) has the molecular formula C9H9N3OS3 and a molecular weight of 271.39 g/mol. Its IUPAC name is 4-methyl-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 4-methyl-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 121029454 |
| Molecular Formula | C9H9N3OS3 |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 4-methyl-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
| SMILES | CSc1nnc(NC(=O)c2cc(C)cs2)s1 |
| InChI | InChI=1S/C9H9N3OS3/c1-5-3-6(15-4-5)7(13)10-8-11-12-9(14-2)16-8/h3-4H,1-2H3,(H,10,11,13) |
| InChIKey | SKDRZTSWDAWBCO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|