C8H7N3O2S2 — CID 836941
N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide (PubChem CID 836941) has the molecular formula C8H7N3O2S2 and a molecular weight of 241.30 g/mol. Its IUPAC name is N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide.
| Compound Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 836941 |
| Molecular Formula | C8H7N3O2S2 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
| SMILES | CSc1nnc(NC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C8H7N3O2S2/c1-14-8-11-10-7(15-8)9-6(12)5-3-2-4-13-5/h2-4H,1H3,(H,9,10,12) |
| InChIKey | OEGYSMUYNKDGCN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|