C10H12N4O2S2 — CID 176585430
N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-3-propan-2-yl-1,2-oxazole-5-carboxamide (PubChem CID 176585430) has the molecular formula C10H12N4O2S2 and a molecular weight of 284.37 g/mol. Its IUPAC name is N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-3-propan-2-yl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-3-propan-2-yl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 176585430 |
| Molecular Formula | C10H12N4O2S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-3-propan-2-yl-1,2-oxazole-5-carboxamide |
| SMILES | CSc1nnc(NC(=O)c2cc(C(C)C)no2)s1 |
| InChI | InChI=1S/C10H12N4O2S2/c1-5(2)6-4-7(16-14-6)8(15)11-9-12-13-10(17-3)18-9/h4-5H,1-3H3,(H,11,12,15) |
| InChIKey | PMCUFZONWUDPFO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|