C11H8N4O2S3 — CID 171781557
N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-3-thiophen-3-yl-1,2-oxazole-5-carboxamide (PubChem CID 171781557) has the molecular formula C11H8N4O2S3 and a molecular weight of 324.41 g/mol. Its IUPAC name is N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-3-thiophen-3-yl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-3-thiophen-3-yl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 171781557 |
| Molecular Formula | C11H8N4O2S3 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-3-thiophen-3-yl-1,2-oxazole-5-carboxamide |
| SMILES | CSc1nnc(NC(=O)c2cc(-c3ccsc3)no2)s1 |
| InChI | InChI=1S/C11H8N4O2S3/c1-18-11-14-13-10(20-11)12-9(16)8-4-7(15-17-8)6-2-3-19-5-6/h2-5H,1H3,(H,12,13,16) |
| InChIKey | WGHLOZRPXZANKG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|