C12H7BrN2O3S — CID 53143253
5-bromo-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)furan-2-carboxamide (PubChem CID 53143253) has the molecular formula C12H7BrN2O3S and a molecular weight of 339.17 g/mol. Its IUPAC name is 5-bromo-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 53143253 |
| Molecular Formula | C12H7BrN2O3S |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | 5-bromo-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1cc(-c2ccsc2)no1)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H7BrN2O3S/c13-10-2-1-9(17-10)12(16)14-11-5-8(15-18-11)7-3-4-19-6-7/h1-6H,(H,14,16) |
| InChIKey | HMTVEYMIJVUDCM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |