C17H16N2O2S — CID 53143270
2-phenyl-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)butanamide (PubChem CID 53143270) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-phenyl-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)butanamide.
| Compound Name | 2-phenyl-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 53143270 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-phenyl-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)butanamide |
| SMILES | CCC(C(=O)Nc1cc(-c2ccsc2)no1)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2S/c1-2-14(12-6-4-3-5-7-12)17(20)18-16-10-15(19-21-16)13-8-9-22-11-13/h3-11,14H,2H2,1H3,(H,18,20) |
| InChIKey | NEZZRVZVSYIGIT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |