C17H16N2O4S — CID 53143312
2-(3,5-dimethoxyphenyl)-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)acetamide (PubChem CID 53143312) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)acetamide.
| Compound Name | 2-(3,5-dimethoxyphenyl)-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 53143312 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2cc(-c3ccsc3)no2)cc(OC)c1 |
| InChI | InChI=1S/C17H16N2O4S/c1-21-13-5-11(6-14(8-13)22-2)7-16(20)18-17-9-15(19-23-17)12-3-4-24-10-12/h3-6,8-10H,7H2,1-2H3,(H,18,20) |
| InChIKey | NWRIEKHYDIMRKR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |