C14H9FN2O2S — CID 53143326
3-fluoro-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)benzamide (PubChem CID 53143326) has the molecular formula C14H9FN2O2S and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-fluoro-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)benzamide.
| Compound Name | 3-fluoro-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 53143326 |
| Molecular Formula | C14H9FN2O2S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 3-fluoro-N-(3-thiophen-3-yl-1,2-oxazol-5-yl)benzamide |
| SMILES | O=C(Nc1cc(-c2ccsc2)no1)c1cccc(F)c1 |
| InChI | InChI=1S/C14H9FN2O2S/c15-11-3-1-2-9(6-11)14(18)16-13-7-12(17-19-13)10-4-5-20-8-10/h1-8H,(H,16,18) |
| InChIKey | LYODNIQXDSZUNJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |