C11H10N4O3S2 — CID 171781527
N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxamide (PubChem CID 171781527) has the molecular formula C11H10N4O3S2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxamide.
| Compound Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 171781527 |
| Molecular Formula | C11H10N4O3S2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxamide |
| SMILES | CSc1nnc(NC(=O)c2onc3c2CCCC3=O)s1 |
| InChI | InChI=1S/C11H10N4O3S2/c1-19-11-14-13-10(20-11)12-9(17)8-5-3-2-4-6(16)7(5)15-18-8/h2-4H2,1H3,(H,12,13,17) |
| InChIKey | OLBLYLXBYWMJNJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|