C14H19ClN4O2S2 — CID 171668669
N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]furan-2-carboxamide;hydrochloride (PubChem CID 171668669) has the molecular formula C14H19ClN4O2S2 and a molecular weight of 374.92 g/mol. Its IUPAC name is N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 171668669 |
| Molecular Formula | C14H19ClN4O2S2 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | N-[5-(2-piperidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]furan-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1nnc(SCCN2CCCCC2)s1)c1ccco1 |
| InChI | InChI=1S/C14H18N4O2S2.ClH/c19-12(11-5-4-9-20-11)15-13-16-17-14(22-13)21-10-8-18-6-2-1-3-7-18;/h4-5,9H,1-3,6-8,10H2,(H,15,16,19);1H |
| InChIKey | FVZNZQNGIRXKBF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|