C11H19ClN4O2S2 — CID 12004721
N-[5-(2-morpholin-4-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide;hydrochloride (PubChem CID 12004721) has the molecular formula C11H19ClN4O2S2 and a molecular weight of 338.89 g/mol. Its IUPAC name is N-[5-(2-morpholin-4-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide;hydrochloride.
| Compound Name | N-[5-(2-morpholin-4-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 12004721 |
| Molecular Formula | C11H19ClN4O2S2 |
| Molecular Weight | 338.89 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[5-(2-morpholin-4-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide;hydrochloride |
| SMILES | CCC(=O)Nc1nnc(SCCN2CCOCC2)s1.Cl |
| InChI | InChI=1S/C11H18N4O2S2.ClH/c1-2-9(16)12-10-13-14-11(19-10)18-8-5-15-3-6-17-7-4-15;/h2-8H2,1H3,(H,12,13,16);1H |
| InChIKey | RTERTNGKXCMGFO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.89 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|