C13H22N4OS3 — CID 134064939
2-[2-(azepan-1-yl)ethylsulfanyl]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 134064939) has the molecular formula C13H22N4OS3 and a molecular weight of 346.55 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)ethylsulfanyl]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[2-(azepan-1-yl)ethylsulfanyl]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 134064939 |
| Molecular Formula | C13H22N4OS3 |
| Molecular Weight | 346.55 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[2-(azepan-1-yl)ethylsulfanyl]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CSc1nnc(NC(=O)CSCCN2CCCCCC2)s1 |
| InChI | InChI=1S/C13H22N4OS3/c1-19-13-16-15-12(21-13)14-11(18)10-20-9-8-17-6-4-2-3-5-7-17/h2-10H2,1H3,(H,14,15,18) |
| InChIKey | HSYMTFUPKBAPID-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|