C9H11N5OS3 — CID 25250353
2-(1-methylimidazol-2-yl)sulfanyl-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 25250353) has the molecular formula C9H11N5OS3 and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)sulfanyl-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(1-methylimidazol-2-yl)sulfanyl-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 25250353 |
| Molecular Formula | C9H11N5OS3 |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)sulfanyl-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CSc1nnc(NC(=O)CSc2nccn2C)s1 |
| InChI | InChI=1S/C9H11N5OS3/c1-14-4-3-10-8(14)17-5-6(15)11-7-12-13-9(16-2)18-7/h3-4H,5H2,1-2H3,(H,11,12,15) |
| InChIKey | WFRXBWOWSCCCLO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|