C18H18N4O2S3 — CID 121029479
N-[5-[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methylthiophene-2-carboxamide (PubChem CID 121029479) has the molecular formula C18H18N4O2S3 and a molecular weight of 418.57 g/mol. Its IUPAC name is N-[5-[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methylthiophene-2-carboxamide.
| Compound Name | N-[5-[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 121029479 |
| Molecular Formula | C18H18N4O2S3 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-[5-[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)CSc2nnc(NC(=O)c3cc(C)cs3)s2)c1 |
| InChI | InChI=1S/C18H18N4O2S3/c1-10-4-11(2)6-13(5-10)19-15(23)9-26-18-22-21-17(27-18)20-16(24)14-7-12(3)8-25-14/h4-8H,9H2,1-3H3,(H,19,23)(H,20,21,24) |
| InChIKey | GPLAIHBTNLHMOO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|