C16H13F2N3O2S2 — CID 121029451
N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 121029451) has the molecular formula C16H13F2N3O2S2 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 121029451 |
| Molecular Formula | C16H13F2N3O2S2 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nnc(SCc3cc(F)ccc3F)s2)c(C)o1 |
| InChI | InChI=1S/C16H13F2N3O2S2/c1-8-5-12(9(2)23-8)14(22)19-15-20-21-16(25-15)24-7-10-6-11(17)3-4-13(10)18/h3-6H,7H2,1-2H3,(H,19,20,22) |
| InChIKey | STXRJRUKBBNRKQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|